C12H18N4O2S2 — CID 61474909
3-amino-1-ethyl-N-(1-thiophen-3-ylpropan-2-yl)pyrazole-4-sulfonamide (PubChem CID 61474909) has the molecular formula C12H18N4O2S2 and a molecular weight of 314.44 g/mol. Its IUPAC name is 3-amino-1-ethyl-N-(1-thiophen-3-ylpropan-2-yl)pyrazole-4-sulfonamide.
| Compound Name | 3-amino-1-ethyl-N-(1-thiophen-3-ylpropan-2-yl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 61474909 |
| Molecular Formula | C12H18N4O2S2 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 3-amino-1-ethyl-N-(1-thiophen-3-ylpropan-2-yl)pyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NC(C)Cc2ccsc2)c(N)n1 |
| InChI | InChI=1S/C12H18N4O2S2/c1-3-16-7-11(12(13)14-16)20(17,18)15-9(2)6-10-4-5-19-8-10/h4-5,7-9,15H,3,6H2,1-2H3,(H2,13,14) |
| InChIKey | SYNUMRJWAVUGPI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |