C10H20N4O2S2 — CID 113494400
3-amino-1-ethyl-N-(1-methylsulfanylbutan-2-yl)pyrazole-4-sulfonamide (PubChem CID 113494400) has the molecular formula C10H20N4O2S2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 3-amino-1-ethyl-N-(1-methylsulfanylbutan-2-yl)pyrazole-4-sulfonamide.
| Compound Name | 3-amino-1-ethyl-N-(1-methylsulfanylbutan-2-yl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 113494400 |
| Molecular Formula | C10H20N4O2S2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 3-amino-1-ethyl-N-(1-methylsulfanylbutan-2-yl)pyrazole-4-sulfonamide |
| SMILES | CCC(CSC)NS(=O)(=O)c1cn(CC)nc1N |
| InChI | InChI=1S/C10H20N4O2S2/c1-4-8(7-17-3)13-18(15,16)9-6-14(5-2)12-10(9)11/h6,8,13H,4-5,7H2,1-3H3,(H2,11,12) |
| InChIKey | UNFHPNOCKYLMEK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |