C7H12F2N4O2S — CID 115405368
3-amino-N-(2,2-difluoroethyl)-1-ethylpyrazole-4-sulfonamide (PubChem CID 115405368) has the molecular formula C7H12F2N4O2S and a molecular weight of 254.26 g/mol. Its IUPAC name is 3-amino-N-(2,2-difluoroethyl)-1-ethylpyrazole-4-sulfonamide.
| Compound Name | 3-amino-N-(2,2-difluoroethyl)-1-ethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 115405368 |
| Molecular Formula | C7H12F2N4O2S |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 3-amino-N-(2,2-difluoroethyl)-1-ethylpyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NCC(F)F)c(N)n1 |
| InChI | InChI=1S/C7H12F2N4O2S/c1-2-13-4-5(7(10)12-13)16(14,15)11-3-6(8)9/h4,6,11H,2-3H2,1H3,(H2,10,12) |
| InChIKey | RQODFRREQGXOON-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |