C11H12F2N4O2S — CID 60815193
3-amino-N-(3,5-difluorophenyl)-1-ethylpyrazole-4-sulfonamide (PubChem CID 60815193) has the molecular formula C11H12F2N4O2S and a molecular weight of 302.31 g/mol. Its IUPAC name is 3-amino-N-(3,5-difluorophenyl)-1-ethylpyrazole-4-sulfonamide.
| Compound Name | 3-amino-N-(3,5-difluorophenyl)-1-ethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60815193 |
| Molecular Formula | C11H12F2N4O2S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 3-amino-N-(3,5-difluorophenyl)-1-ethylpyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)Nc2cc(F)cc(F)c2)c(N)n1 |
| InChI | InChI=1S/C11H12F2N4O2S/c1-2-17-6-10(11(14)15-17)20(18,19)16-9-4-7(12)3-8(13)5-9/h3-6,16H,2H2,1H3,(H2,14,15) |
| InChIKey | DAJWKQKZEMSRHY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |