C10H20N4O4S2 — CID 79551640
3-amino-1-ethyl-N-(2-methyl-2-methylsulfonylpropyl)pyrazole-4-sulfonamide (PubChem CID 79551640) has the molecular formula C10H20N4O4S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is 3-amino-1-ethyl-N-(2-methyl-2-methylsulfonylpropyl)pyrazole-4-sulfonamide.
| Compound Name | 3-amino-1-ethyl-N-(2-methyl-2-methylsulfonylpropyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 79551640 |
| Molecular Formula | C10H20N4O4S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 3-amino-1-ethyl-N-(2-methyl-2-methylsulfonylpropyl)pyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NCC(C)(C)S(C)(=O)=O)c(N)n1 |
| InChI | InChI=1S/C10H20N4O4S2/c1-5-14-6-8(9(11)13-14)20(17,18)12-7-10(2,3)19(4,15)16/h6,12H,5,7H2,1-4H3,(H2,11,13) |
| InChIKey | QEBGGHRQFKBVHK-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |