C9H18N4O3S — CID 106840218
3-amino-1-ethyl-N-(4-hydroxybutyl)pyrazole-4-sulfonamide (PubChem CID 106840218) has the molecular formula C9H18N4O3S and a molecular weight of 262.33 g/mol. Its IUPAC name is 3-amino-1-ethyl-N-(4-hydroxybutyl)pyrazole-4-sulfonamide.
| Compound Name | 3-amino-1-ethyl-N-(4-hydroxybutyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106840218 |
| Molecular Formula | C9H18N4O3S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 3-amino-1-ethyl-N-(4-hydroxybutyl)pyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NCCCCO)c(N)n1 |
| InChI | InChI=1S/C9H18N4O3S/c1-2-13-7-8(9(10)12-13)17(15,16)11-5-3-4-6-14/h7,11,14H,2-6H2,1H3,(H2,10,12) |
| InChIKey | YLIBOMRNXQBWGU-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|