C11H22N4O3S — CID 61240299
3-amino-1-ethyl-N-(1-hydroxy-4-methylpentan-2-yl)pyrazole-4-sulfonamide (PubChem CID 61240299) has the molecular formula C11H22N4O3S and a molecular weight of 290.39 g/mol. Its IUPAC name is 3-amino-1-ethyl-N-(1-hydroxy-4-methylpentan-2-yl)pyrazole-4-sulfonamide.
| Compound Name | 3-amino-1-ethyl-N-(1-hydroxy-4-methylpentan-2-yl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 61240299 |
| Molecular Formula | C11H22N4O3S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 3-amino-1-ethyl-N-(1-hydroxy-4-methylpentan-2-yl)pyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NC(CO)CC(C)C)c(N)n1 |
| InChI | InChI=1S/C11H22N4O3S/c1-4-15-6-10(11(12)13-15)19(17,18)14-9(7-16)5-8(2)3/h6,8-9,14,16H,4-5,7H2,1-3H3,(H2,12,13) |
| InChIKey | PWRFYBVLHTUCQR-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |