C11H20N4O3S — CID 106358780
3-amino-1-ethyl-N-[2-(hydroxymethyl)cyclopentyl]pyrazole-4-sulfonamide (PubChem CID 106358780) has the molecular formula C11H20N4O3S and a molecular weight of 288.37 g/mol. Its IUPAC name is 3-amino-1-ethyl-N-[2-(hydroxymethyl)cyclopentyl]pyrazole-4-sulfonamide.
| Compound Name | 3-amino-1-ethyl-N-[2-(hydroxymethyl)cyclopentyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106358780 |
| Molecular Formula | C11H20N4O3S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 3-amino-1-ethyl-N-[2-(hydroxymethyl)cyclopentyl]pyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NC2CCCC2CO)c(N)n1 |
| InChI | InChI=1S/C11H20N4O3S/c1-2-15-6-10(11(12)13-15)19(17,18)14-9-5-3-4-8(9)7-16/h6,8-9,14,16H,2-5,7H2,1H3,(H2,12,13) |
| InChIKey | YPGLUXBLNCUHRD-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |