C8H16N4O3S — CID 107213382
3-amino-N-[(2R)-1-hydroxybutan-2-yl]-1-methylpyrazole-4-sulfonamide (PubChem CID 107213382) has the molecular formula C8H16N4O3S and a molecular weight of 248.31 g/mol. Its IUPAC name is 3-amino-N-[(2R)-1-hydroxybutan-2-yl]-1-methylpyrazole-4-sulfonamide.
| Compound Name | 3-amino-N-[(2R)-1-hydroxybutan-2-yl]-1-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 107213382 |
| Molecular Formula | C8H16N4O3S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 3-amino-N-[(2R)-1-hydroxybutan-2-yl]-1-methylpyrazole-4-sulfonamide |
| SMILES | CC[C@H](CO)NS(=O)(=O)c1cn(C)nc1N |
| InChI | InChI=1S/C8H16N4O3S/c1-3-6(5-13)11-16(14,15)7-4-12(2)10-8(7)9/h4,6,11,13H,3,5H2,1-2H3,(H2,9,10)/t6-/m1/s1 |
| InChIKey | ZVEUOQPKORBMNJ-ZCFIWIBFSA-N |
| XLogP | -0.95 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |