C12H24N4O2S — CID 61125115
3-amino-N-(4-methylpentyl)-1-propylpyrazole-4-sulfonamide (PubChem CID 61125115) has the molecular formula C12H24N4O2S and a molecular weight of 288.42 g/mol. Its IUPAC name is 3-amino-N-(4-methylpentyl)-1-propylpyrazole-4-sulfonamide.
| Compound Name | 3-amino-N-(4-methylpentyl)-1-propylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 61125115 |
| Molecular Formula | C12H24N4O2S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 3-amino-N-(4-methylpentyl)-1-propylpyrazole-4-sulfonamide |
| SMILES | CCCn1cc(S(=O)(=O)NCCCC(C)C)c(N)n1 |
| InChI | InChI=1S/C12H24N4O2S/c1-4-8-16-9-11(12(13)15-16)19(17,18)14-7-5-6-10(2)3/h9-10,14H,4-8H2,1-3H3,(H2,13,15) |
| InChIKey | SIJUBOGZOKNXGT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|