C13H24N4O2S — CID 60919717
3-amino-N-(2-cyclopentylethyl)-1-propylpyrazole-4-sulfonamide (PubChem CID 60919717) has the molecular formula C13H24N4O2S and a molecular weight of 300.43 g/mol. Its IUPAC name is 3-amino-N-(2-cyclopentylethyl)-1-propylpyrazole-4-sulfonamide.
| Compound Name | 3-amino-N-(2-cyclopentylethyl)-1-propylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60919717 |
| Molecular Formula | C13H24N4O2S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 3-amino-N-(2-cyclopentylethyl)-1-propylpyrazole-4-sulfonamide |
| SMILES | CCCn1cc(S(=O)(=O)NCCC2CCCC2)c(N)n1 |
| InChI | InChI=1S/C13H24N4O2S/c1-2-9-17-10-12(13(14)16-17)20(18,19)15-8-7-11-5-3-4-6-11/h10-11,15H,2-9H2,1H3,(H2,14,16) |
| InChIKey | UYAZGBGYRKOWSF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |