C11H10BrN3O2S — CID 65480598
4-(bromomethyl)-N,N-bis(cyanomethyl)benzenesulfonamide (PubChem CID 65480598) has the molecular formula C11H10BrN3O2S and a molecular weight of 328.19 g/mol. Its IUPAC name is 4-(bromomethyl)-N,N-bis(cyanomethyl)benzenesulfonamide.
| Compound Name | 4-(bromomethyl)-N,N-bis(cyanomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 65480598 |
| Molecular Formula | C11H10BrN3O2S |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | 4-(bromomethyl)-N,N-bis(cyanomethyl)benzenesulfonamide |
| SMILES | N#CCN(CC#N)S(=O)(=O)c1ccc(CBr)cc1 |
| InChI | InChI=1S/C11H10BrN3O2S/c12-9-10-1-3-11(4-2-10)18(16,17)15(7-5-13)8-6-14/h1-4H,7-9H2 |
| InChIKey | JYVWMFKMDNGVLZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 84.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|