C12H11N3O3S — CID 29050568
4-acetyl-N,N-bis(cyanomethyl)benzenesulfonamide (PubChem CID 29050568) has the molecular formula C12H11N3O3S and a molecular weight of 277.31 g/mol. Its IUPAC name is 4-acetyl-N,N-bis(cyanomethyl)benzenesulfonamide.
| Compound Name | 4-acetyl-N,N-bis(cyanomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 29050568 |
| Molecular Formula | C12H11N3O3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 4-acetyl-N,N-bis(cyanomethyl)benzenesulfonamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N(CC#N)CC#N)cc1 |
| InChI | InChI=1S/C12H11N3O3S/c1-10(16)11-2-4-12(5-3-11)19(17,18)15(8-6-13)9-7-14/h2-5H,8-9H2,1H3 |
| InChIKey | UHYDWUZMXGBKIN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 102.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|