About 2-chloro-N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-4-methylpyridin-3-amine
2-chloro-N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-4-methylpyridin-3-amine (PubChem CID 65482965) has the molecular formula C16H25ClN2O
and a molecular weight of 296.84 g/mol. Its IUPAC name is 2-chloro-N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-4-methylpyridin-3-amine.
Molecular Properties
| Compound Name | 2-chloro-N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-4-methylpyridin-3-amine |
| PubChem CID | 65482965 |
| Molecular Formula | C16H25ClN2O |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2-chloro-N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-4-methylpyridin-3-amine |
| SMILES | Cc1ccnc(Cl)c1NC1CC(OCC(C)C)C1(C)C |
| InChI | InChI=1S/C16H25ClN2O/c1-10(2)9-20-13-8-12(16(13,4)5)19-14-11(3)6-7-18-15(14)17/h6-7,10,12-13,19H,8-9H2,1-5H3 |
| InChIKey | SZTADGXSCFMXKN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-4-methylpyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-4-methylpyridin-3-amine?
The IUPAC name of 2-chloro-N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-4-methylpyridin-3-amine (CID 65482965) is 2-chloro-N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-4-methylpyridin-3-amine.
What is the SMILES notation for 2-chloro-N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-4-methylpyridin-3-amine?
The canonical SMILES for 2-chloro-N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-4-methylpyridin-3-amine is Cc1ccnc(Cl)c1NC1CC(OCC(C)C)C1(C)C.
What is the InChIKey of 2-chloro-N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-4-methylpyridin-3-amine?
The InChIKey is SZTADGXSCFMXKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25ClN2O/c1-10(2)9-20-13-8-12(16(13,4)5)19-14-11(3)6-7-18-15(14)17/h6-7,10,12-13,19H,8-9H2,1-5H3.
What are the key properties of 2-chloro-N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-4-methylpyridin-3-amine?
2-chloro-N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-4-methylpyridin-3-amine has a molecular weight of 296.84 g/mol, XLogP of 4.30, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[2,2-dimethyl-3-(2-methylpropoxy)cyclobutyl]-4-methylpyridin-3-amine is sourced from PubChem (CID 65482965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).