C15H14ClN5 — CID 65483739
2-chloro-4-methyl-N-[(5-phenyl-2H-triazol-4-yl)methyl]pyridin-3-amine (PubChem CID 65483739) has the molecular formula C15H14ClN5 and a molecular weight of 299.77 g/mol. Its IUPAC name is 2-chloro-4-methyl-N-[(5-phenyl-2H-triazol-4-yl)methyl]pyridin-3-amine.
| Compound Name | 2-chloro-4-methyl-N-[(5-phenyl-2H-triazol-4-yl)methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 65483739 |
| Molecular Formula | C15H14ClN5 |
| Molecular Weight | 299.77 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-chloro-4-methyl-N-[(5-phenyl-2H-triazol-4-yl)methyl]pyridin-3-amine |
| SMILES | Cc1ccnc(Cl)c1NCc1n[nH]nc1-c1ccccc1 |
| InChI | InChI=1S/C15H14ClN5/c1-10-7-8-17-15(16)13(10)18-9-12-14(20-21-19-12)11-5-3-2-4-6-11/h2-8,18H,9H2,1H3,(H,19,20,21) |
| InChIKey | OKJDXUMAIGPSEW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.77 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|