C15H26N2O — CID 65486266
N-(2-methoxyethyl)-N'-methyl-N'-(2-phenylethyl)propane-1,3-diamine (PubChem CID 65486266) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N'-methyl-N'-(2-phenylethyl)propane-1,3-diamine.
| Compound Name | N-(2-methoxyethyl)-N'-methyl-N'-(2-phenylethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 65486266 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | N-(2-methoxyethyl)-N'-methyl-N'-(2-phenylethyl)propane-1,3-diamine |
| SMILES | COCCNCCCN(C)CCc1ccccc1 |
| InChI | InChI=1S/C15H26N2O/c1-17(12-6-10-16-11-14-18-2)13-9-15-7-4-3-5-8-15/h3-5,7-8,16H,6,9-14H2,1-2H3 |
| InChIKey | NMGZPTUYTWHSBI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|