C13H15N3O4S — CID 65486795
3-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)-5-methylsulfonylbenzamide (PubChem CID 65486795) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is 3-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)-5-methylsulfonylbenzamide.
| Compound Name | 3-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 65486795 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 3-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)-5-methylsulfonylbenzamide |
| SMILES | Cc1noc(NC(=O)c2cc(N)cc(S(C)(=O)=O)c2)c1C |
| InChI | InChI=1S/C13H15N3O4S/c1-7-8(2)16-20-13(7)15-12(17)9-4-10(14)6-11(5-9)21(3,18)19/h4-6H,14H2,1-3H3,(H,15,17) |
| InChIKey | PAUWTHAISGWRET-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|