C11H11Cl2N3O3S — CID 65488136
4-amino-2,6-dichloro-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide (PubChem CID 65488136) has the molecular formula C11H11Cl2N3O3S and a molecular weight of 336.20 g/mol. Its IUPAC name is 4-amino-2,6-dichloro-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide.
| Compound Name | 4-amino-2,6-dichloro-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 65488136 |
| Molecular Formula | C11H11Cl2N3O3S |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | 4-amino-2,6-dichloro-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide |
| SMILES | Cc1noc(NS(=O)(=O)c2c(Cl)cc(N)cc2Cl)c1C |
| InChI | InChI=1S/C11H11Cl2N3O3S/c1-5-6(2)15-19-11(5)16-20(17,18)10-8(12)3-7(14)4-9(10)13/h3-4,16H,14H2,1-2H3 |
| InChIKey | RTSUCQFNPQFHKJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|