C10H13N5O3S — CID 65488718
N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-hydrazinylpyridine-3-sulfonamide (PubChem CID 65488718) has the molecular formula C10H13N5O3S and a molecular weight of 283.31 g/mol. Its IUPAC name is N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-hydrazinylpyridine-3-sulfonamide.
| Compound Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-hydrazinylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 65488718 |
| Molecular Formula | C10H13N5O3S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-4-hydrazinylpyridine-3-sulfonamide |
| SMILES | Cc1noc(NS(=O)(=O)c2cnccc2NN)c1C |
| InChI | InChI=1S/C10H13N5O3S/c1-6-7(2)14-18-10(6)15-19(16,17)9-5-12-4-3-8(9)13-11/h3-5,15H,11H2,1-2H3,(H,12,13) |
| InChIKey | HPTKKUYIMSYZCF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|