C12H10INO2 — CID 65489723
3-[(4-iodophenyl)methyl]-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 65489723) has the molecular formula C12H10INO2 and a molecular weight of 327.12 g/mol. Its IUPAC name is 3-[(4-iodophenyl)methyl]-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 3-[(4-iodophenyl)methyl]-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 65489723 |
| Molecular Formula | C12H10INO2 |
| Molecular Weight | 327.12 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | 3-[(4-iodophenyl)methyl]-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | O=C1C2CC2C(=O)N1Cc1ccc(I)cc1 |
| InChI | InChI=1S/C12H10INO2/c13-8-3-1-7(2-4-8)6-14-11(15)9-5-10(9)12(14)16/h1-4,9-10H,5-6H2 |
| InChIKey | QRUOPYSIXIWHJK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.12 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|