C15H24IN3 — CID 65490706
2-[4-[(4-iodophenyl)methyl]piperazin-1-yl]-N,N-dimethylethanamine (PubChem CID 65490706) has the molecular formula C15H24IN3 and a molecular weight of 373.28 g/mol. Its IUPAC name is 2-[4-[(4-iodophenyl)methyl]piperazin-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[4-[(4-iodophenyl)methyl]piperazin-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 65490706 |
| Molecular Formula | C15H24IN3 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 2-[4-[(4-iodophenyl)methyl]piperazin-1-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCN1CCN(Cc2ccc(I)cc2)CC1 |
| InChI | InChI=1S/C15H24IN3/c1-17(2)7-8-18-9-11-19(12-10-18)13-14-3-5-15(16)6-4-14/h3-6H,7-13H2,1-2H3 |
| InChIKey | LERHWOKUMKTCNG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|