C13H19IN2 — CID 65491766
1-[(4-iodophenyl)methyl]-3-methyl-1,4-diazepane (PubChem CID 65491766) has the molecular formula C13H19IN2 and a molecular weight of 330.21 g/mol. Its IUPAC name is 1-[(4-iodophenyl)methyl]-3-methyl-1,4-diazepane.
| Compound Name | 1-[(4-iodophenyl)methyl]-3-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 65491766 |
| Molecular Formula | C13H19IN2 |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 1-[(4-iodophenyl)methyl]-3-methyl-1,4-diazepane |
| SMILES | CC1CN(Cc2ccc(I)cc2)CCCN1 |
| InChI | InChI=1S/C13H19IN2/c1-11-9-16(8-2-7-15-11)10-12-3-5-13(14)6-4-12/h3-6,11,15H,2,7-10H2,1H3 |
| InChIKey | WFBBLBCMKOYEHJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|