2-[1-(methoxymethyl)cyclopropyl]acetic acid

C7H12O3 — CID 65496553

IUPAC2-[1-(methoxymethyl)cyclopropyl]acetic acid
SMILESCOCC1(CC(=O)O)CC1
InChIInChI=1S/C7H12O3/c1-10-5-7(2-3-7)4-6(8)9/h2-5H2,1H3,(H,8,9)
InChIKeyNGVYBKMHZWOAIG-UHFFFAOYSA-N
MW144.17 g/mol
LogP0.89
Rot. Bonds4

About 2-[1-(methoxymethyl)cyclopropyl]acetic acid

2-[1-(methoxymethyl)cyclopropyl]acetic acid (PubChem CID 65496553) has the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. Its IUPAC name is 2-[1-(methoxymethyl)cyclopropyl]acetic acid.

Molecular Properties

Compound Name2-[1-(methoxymethyl)cyclopropyl]acetic acid
PubChem CID65496553
Molecular FormulaC7H12O3
Molecular Weight144.17 g/mol
Exact Mass144.08
IUPAC Name2-[1-(methoxymethyl)cyclopropyl]acetic acid
SMILESCOCC1(CC(=O)O)CC1
InChIInChI=1S/C7H12O3/c1-10-5-7(2-3-7)4-6(8)9/h2-5H2,1H3,(H,8,9)
InChIKeyNGVYBKMHZWOAIG-UHFFFAOYSA-N
XLogP0.89
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500144.17
LogP ≤ 50.89
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[1-(methoxymethyl)cyclopropyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(1-Methylcyclopropyl)acetic acid
CID 15579944
4-Methyloxane-4-carboxylic acid
CID 11571820
2-(1-(Hydroxymethyl)cyclopropyl)acetic acid
CID 22404474
(1-Hydroxymethylcyclopropyl)acetic acid methyl ester
CID 29941748
2-Ethyl-4-methoxybutanoic acid
CID 53837209
1-(2-Methoxy-2-oxoethyl)cyclopropane-1-carboxylic acid
CID 59620516
1-(2-Methoxyethyl)cyclopropane-1-carboxylic acid
CID 66023970
1-(2-Hydroxyethyl)cyclopropane-1-carboxylic acid
CID 75356213
2-Ethyl-4-methoxy-2-methylbutanoic acid
CID 62740257
2-[1-(Methoxycarbonyl)cyclopropyl]acetic acid
CID 145908100
2-(3-Ethyloxetan-3-yl)acetic acid
CID 84071604
1-[2-(Trifluoromethoxy)ethyl]cyclopropane-1-carboxylic acid
CID 79425421

Frequently Asked Questions

What is the IUPAC name of 2-[1-(methoxymethyl)cyclopropyl]acetic acid?
The IUPAC name of 2-[1-(methoxymethyl)cyclopropyl]acetic acid (CID 65496553) is 2-[1-(methoxymethyl)cyclopropyl]acetic acid.
What is the SMILES notation for 2-[1-(methoxymethyl)cyclopropyl]acetic acid?
The canonical SMILES for 2-[1-(methoxymethyl)cyclopropyl]acetic acid is COCC1(CC(=O)O)CC1.
What is the InChIKey of 2-[1-(methoxymethyl)cyclopropyl]acetic acid?
The InChIKey is NGVYBKMHZWOAIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3/c1-10-5-7(2-3-7)4-6(8)9/h2-5H2,1H3,(H,8,9).
What are the key properties of 2-[1-(methoxymethyl)cyclopropyl]acetic acid?
2-[1-(methoxymethyl)cyclopropyl]acetic acid has a molecular weight of 144.17 g/mol, XLogP of 0.89, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(methoxymethyl)cyclopropyl]acetic acid is sourced from PubChem (CID 65496553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).