C14H10INO3 — CID 6554099
(3aR,4R,7S,7aR)-2-(2-iodophenyl)-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 6554099) has the molecular formula C14H10INO3 and a molecular weight of 367.14 g/mol. Its IUPAC name is (3aR,4R,7S,7aR)-2-(2-iodophenyl)-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4R,7S,7aR)-2-(2-iodophenyl)-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 6554099 |
| Molecular Formula | C14H10INO3 |
| Molecular Weight | 367.14 g/mol |
| Exact Mass | 366.97 |
| IUPAC Name | (3aR,4R,7S,7aR)-2-(2-iodophenyl)-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2[C@@H](C(=O)N1c1ccccc1I)[C@H]1C=C[C@@H]2O1 |
| InChI | InChI=1S/C14H10INO3/c15-7-3-1-2-4-8(7)16-13(17)11-9-5-6-10(19-9)12(11)14(16)18/h1-6,9-12H/t9-,10+,11-,12-/m0/s1 |
| InChIKey | AGMFLMVSSRHZDV-USZNOCQGSA-N |
| XLogP | 1.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.14 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|