C25H33FN2O3 — CID 6556716
(1R,4S,5S,8R,9S,12R,14R)-4-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-8,12-dimethyl-2,13-dioxatetracyclo[7.5.0.01,5.012,14]tetradecan-3-one (PubChem CID 6556716) has the molecular formula C25H33FN2O3 and a molecular weight of 428.55 g/mol. Its IUPAC name is (1R,4S,5S,8R,9S,12R,14R)-4-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-8,12-dimethyl-2,13-dioxatetracyclo[7.5.0.01,5.012,14]tetradecan-3-one.
| Compound Name | (1R,4S,5S,8R,9S,12R,14R)-4-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-8,12-dimethyl-2,13-dioxatetracyclo[7.5.0.01,5.012,14]tetradecan-3-one |
|---|---|
| PubChem CID | 6556716 |
| Molecular Formula | C25H33FN2O3 |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | (1R,4S,5S,8R,9S,12R,14R)-4-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-8,12-dimethyl-2,13-dioxatetracyclo[7.5.0.01,5.012,14]tetradecan-3-one |
| SMILES | C[C@@H]1CC[C@H]2[C@@H](CN3CCN(c4ccccc4F)CC3)C(=O)O[C@]23[C@H]1CC[C@@]1(C)O[C@@H]31 |
| InChI | InChI=1S/C25H33FN2O3/c1-16-7-8-19-17(22(29)30-25(19)18(16)9-10-24(2)23(25)31-24)15-27-11-13-28(14-12-27)21-6-4-3-5-20(21)26/h3-6,16-19,23H,7-15H2,1-2H3/t16-,17-,18+,19+,23-,24-,25-/m1/s1 |
| InChIKey | UDPFOMKNYCYJOB-MFMFHFLBSA-N |
| XLogP | 3.47 |
| TPSA | 45.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|