C29H26N2O5 — CID 6558641
(9S,12R)-9-(furan-2-yl)-12-(3,4,5-trimethoxyphenyl)-8,9,10,12-tetrahydro-7H-benzo[b][4,7]phenanthrolin-11-one (PubChem CID 6558641) has the molecular formula C29H26N2O5 and a molecular weight of 482.54 g/mol. Its IUPAC name is (9S,12R)-9-(furan-2-yl)-12-(3,4,5-trimethoxyphenyl)-8,9,10,12-tetrahydro-7H-benzo[b][4,7]phenanthrolin-11-one.
| Compound Name | (9S,12R)-9-(furan-2-yl)-12-(3,4,5-trimethoxyphenyl)-8,9,10,12-tetrahydro-7H-benzo[b][4,7]phenanthrolin-11-one |
|---|---|
| PubChem CID | 6558641 |
| Molecular Formula | C29H26N2O5 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | (9S,12R)-9-(furan-2-yl)-12-(3,4,5-trimethoxyphenyl)-8,9,10,12-tetrahydro-7H-benzo[b][4,7]phenanthrolin-11-one |
| SMILES | COc1cc([C@H]2C3=C(C[C@H](c4ccco4)CC3=O)Nc3ccc4ncccc4c32)cc(OC)c1OC |
| InChI | InChI=1S/C29H26N2O5/c1-33-24-14-17(15-25(34-2)29(24)35-3)26-27-18-6-4-10-30-19(18)8-9-20(27)31-21-12-16(13-22(32)28(21)26)23-7-5-11-36-23/h4-11,14-16,26,31H,12-13H2,1-3H3/t16-,26+/m0/s1 |
| InChIKey | CTXLUEZNPQUBPC-YHAMSUFESA-N |
| XLogP | 5.81 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |