C13H23N3O2S2 — CID 6559565
N-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-4-methylsulfonylpiperazine-1-carbothioamide (PubChem CID 6559565) has the molecular formula C13H23N3O2S2 and a molecular weight of 317.48 g/mol. Its IUPAC name is N-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-4-methylsulfonylpiperazine-1-carbothioamide.
| Compound Name | N-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-4-methylsulfonylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 6559565 |
| Molecular Formula | C13H23N3O2S2 |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-4-methylsulfonylpiperazine-1-carbothioamide |
| SMILES | CS(=O)(=O)N1CCN(C(=S)N[C@@H]2C[C@@H]3CC[C@H]2C3)CC1 |
| InChI | InChI=1S/C13H23N3O2S2/c1-20(17,18)16-6-4-15(5-7-16)13(19)14-12-9-10-2-3-11(12)8-10/h10-12H,2-9H2,1H3,(H,14,19)/t10-,11+,12-/m1/s1 |
| InChIKey | SJVGEJSXUISJDM-GRYCIOLGSA-N |
| XLogP | 0.63 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|