C13H24N3S+ — CID 11919172
N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-4-methylpiperazin-4-ium-1-carbothioamide (PubChem CID 11919172) has the molecular formula C13H24N3S+ and a molecular weight of 254.42 g/mol. Its IUPAC name is N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-4-methylpiperazin-4-ium-1-carbothioamide.
| Compound Name | N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-4-methylpiperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 11919172 |
| Molecular Formula | C13H24N3S+ |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | N-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-4-methylpiperazin-4-ium-1-carbothioamide |
| SMILES | C[NH+]1CCN(C(=S)N[C@H]2C[C@H]3CC[C@@H]2C3)CC1 |
| InChI | InChI=1S/C13H23N3S/c1-15-4-6-16(7-5-15)13(17)14-12-9-10-2-3-11(12)8-10/h10-12H,2-9H2,1H3,(H,14,17)/p+1/t10-,11+,12-/m0/s1 |
| InChIKey | BMPRLRUJYVIOHZ-TUAOUCFPSA-O |
| XLogP | -0.12 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|