About Isobutanol
Isobutanol (PubChem CID 6560) has the molecular formula C4H10O
and a molecular weight of 74.12 g/mol. Its IUPAC name is 2-methylpropan-1-ol.
Molecular Properties
| Compound Name | Isobutanol |
| PubChem CID | 6560 |
| Molecular Formula | C4H10O |
| Molecular Weight | 74.12 g/mol |
| Exact Mass | 74.07 |
| IUPAC Name | 2-methylpropan-1-ol |
| SMILES | CC(C)CO |
| InChI | InChI=1S/C4H10O/c1-4(2)3-5/h4-5H,3H2,1-2H3 |
| InChIKey | ZXEKIIBDNHEJCQ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | 17 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 74.12 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze Isobutanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Isobutanol?
The IUPAC name of Isobutanol (CID 6560) is 2-methylpropan-1-ol.
What is the SMILES notation for Isobutanol?
The canonical SMILES for Isobutanol is CC(C)CO.
What is the InChIKey of Isobutanol?
The InChIKey is ZXEKIIBDNHEJCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O/c1-4(2)3-5/h4-5H,3H2,1-2H3.
What are the key properties of Isobutanol?
Isobutanol has a molecular weight of 74.12 g/mol, XLogP of 0.80, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Isobutanol is sourced from PubChem (CID 6560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).