methyl 2-(3-cyano-7-ethoxyquinolin-2-yl)sulfanylacetate

C15H14N2O3S — CID 656128

IUPACmethyl 2-(3-cyano-7-ethoxyquinolin-2-yl)sulfanylacetate
SMILESCCOc1ccc2cc(C#N)c(SCC(=O)OC)nc2c1
InChIInChI=1S/C15H14N2O3S/c1-3-20-12-5-4-10-6-11(8-16)15(17-13(10)7-12)21-9-14(18)19-2/h4-7H,3,9H2,1-2H3
InChIKeyBNHBWNCPVUXJFN-UHFFFAOYSA-N
MW302.36 g/mol
LogP2.77
Rot. Bonds5

About methyl 2-(3-cyano-7-ethoxyquinolin-2-yl)sulfanylacetate

methyl 2-(3-cyano-7-ethoxyquinolin-2-yl)sulfanylacetate (PubChem CID 656128) has the molecular formula C15H14N2O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is methyl 2-(3-cyano-7-ethoxyquinolin-2-yl)sulfanylacetate.

Molecular Properties

Compound Namemethyl 2-(3-cyano-7-ethoxyquinolin-2-yl)sulfanylacetate
PubChem CID656128
Molecular FormulaC15H14N2O3S
Molecular Weight302.36 g/mol
Exact Mass302.07
IUPAC Namemethyl 2-(3-cyano-7-ethoxyquinolin-2-yl)sulfanylacetate
SMILESCCOc1ccc2cc(C#N)c(SCC(=O)OC)nc2c1
InChIInChI=1S/C15H14N2O3S/c1-3-20-12-5-4-10-6-11(8-16)15(17-13(10)7-12)21-9-14(18)19-2/h4-7H,3,9H2,1-2H3
InChIKeyBNHBWNCPVUXJFN-UHFFFAOYSA-N
XLogP2.77
TPSA72.21 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.36
LogP ≤ 52.77
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 2-(3-cyano-7-ethoxyquinolin-2-yl)sulfanylacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(3-cyano-7-ethoxyquinolin-2-yl)sulfanylacetate?
The IUPAC name of methyl 2-(3-cyano-7-ethoxyquinolin-2-yl)sulfanylacetate (CID 656128) is methyl 2-(3-cyano-7-ethoxyquinolin-2-yl)sulfanylacetate.
What is the SMILES notation for methyl 2-(3-cyano-7-ethoxyquinolin-2-yl)sulfanylacetate?
The canonical SMILES for methyl 2-(3-cyano-7-ethoxyquinolin-2-yl)sulfanylacetate is CCOc1ccc2cc(C#N)c(SCC(=O)OC)nc2c1.
What is the InChIKey of methyl 2-(3-cyano-7-ethoxyquinolin-2-yl)sulfanylacetate?
The InChIKey is BNHBWNCPVUXJFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O3S/c1-3-20-12-5-4-10-6-11(8-16)15(17-13(10)7-12)21-9-14(18)19-2/h4-7H,3,9H2,1-2H3.
What are the key properties of methyl 2-(3-cyano-7-ethoxyquinolin-2-yl)sulfanylacetate?
methyl 2-(3-cyano-7-ethoxyquinolin-2-yl)sulfanylacetate has a molecular weight of 302.36 g/mol, XLogP of 2.77, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3-cyano-7-ethoxyquinolin-2-yl)sulfanylacetate is sourced from PubChem (CID 656128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).