C7H13NO4S — CID 6562799
2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]acetic acid (PubChem CID 6562799) has the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. Its IUPAC name is 2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]acetic acid.
| Compound Name | 2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 6562799 |
| Molecular Formula | C7H13NO4S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H13NO4S/c1-8(4-7(9)10)6-2-3-13(11,12)5-6/h6H,2-5H2,1H3,(H,9,10)/t6-/m0/s1 |
| InChIKey | YKGBSBFRRDPBPB-LURJTMIESA-N |
| XLogP | -0.81 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |