C18H28O — CID 6569093
(1R,4S,5S,8R)-4-[(1S,6S)-4,6-dimethylcyclohex-3-en-1-yl]-6,8-dimethyl-3-oxabicyclo[3.3.1]non-6-ene (PubChem CID 6569093) has the molecular formula C18H28O and a molecular weight of 260.42 g/mol. Its IUPAC name is (1R,4S,5S,8R)-4-[(1S,6S)-4,6-dimethylcyclohex-3-en-1-yl]-6,8-dimethyl-3-oxabicyclo[3.3.1]non-6-ene.
| Compound Name | (1R,4S,5S,8R)-4-[(1S,6S)-4,6-dimethylcyclohex-3-en-1-yl]-6,8-dimethyl-3-oxabicyclo[3.3.1]non-6-ene |
|---|---|
| PubChem CID | 6569093 |
| Molecular Formula | C18H28O |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | (1R,4S,5S,8R)-4-[(1S,6S)-4,6-dimethylcyclohex-3-en-1-yl]-6,8-dimethyl-3-oxabicyclo[3.3.1]non-6-ene |
| SMILES | CC1=CC[C@H]([C@@H]2OC[C@@H]3C[C@H]2C(C)=C[C@H]3C)[C@@H](C)C1 |
| InChI | InChI=1S/C18H28O/c1-11-5-6-16(13(3)7-11)18-17-9-15(10-19-18)12(2)8-14(17)4/h5,8,12-13,15-18H,6-7,9-10H2,1-4H3/t12-,13+,15+,16+,17+,18+/m1/s1 |
| InChIKey | WBKMHGSGQSVCJQ-YPSWSQRGSA-N |
| XLogP | 4.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|