C28H18N4O11 — CID 657141
4-[2,4-bis[(3-nitrobenzoyl)amino]phenoxy]phthalic acid (PubChem CID 657141) has the molecular formula C28H18N4O11 and a molecular weight of 586.47 g/mol. Its IUPAC name is 4-[2,4-bis[(3-nitrobenzoyl)amino]phenoxy]phthalic acid.
| Compound Name | 4-[2,4-bis[(3-nitrobenzoyl)amino]phenoxy]phthalic acid |
|---|---|
| PubChem CID | 657141 |
| Molecular Formula | C28H18N4O11 |
| Molecular Weight | 586.47 g/mol |
| Exact Mass | 586.10 |
| IUPAC Name | 4-[2,4-bis[(3-nitrobenzoyl)amino]phenoxy]phthalic acid |
| SMILES | O=C(Nc1ccc(Oc2ccc(C(=O)O)c(C(=O)O)c2)c(NC(=O)c2cccc([N+](=O)[O-])c2)c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H18N4O11/c33-25(15-3-1-5-18(11-15)31(39)40)29-17-7-10-24(43-20-8-9-21(27(35)36)22(14-20)28(37)38)23(13-17)30-26(34)16-4-2-6-19(12-16)32(41)42/h1-14H,(H,29,33)(H,30,34)(H,35,36)(H,37,38) |
| InChIKey | VFYAZSTYKPFSFL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 228.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|