C15H20NO2+ — CID 6572752
(1S)-6,7-dimethoxy-1-methyl-2-prop-2-ynyl-1,2,3,4-tetrahydroisoquinolin-2-ium (PubChem CID 6572752) has the molecular formula C15H20NO2+ and a molecular weight of 246.33 g/mol. Its IUPAC name is (1S)-6,7-dimethoxy-1-methyl-2-prop-2-ynyl-1,2,3,4-tetrahydroisoquinolin-2-ium.
| Compound Name | (1S)-6,7-dimethoxy-1-methyl-2-prop-2-ynyl-1,2,3,4-tetrahydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 6572752 |
| Molecular Formula | C15H20NO2+ |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | (1S)-6,7-dimethoxy-1-methyl-2-prop-2-ynyl-1,2,3,4-tetrahydroisoquinolin-2-ium |
| SMILES | C#CC[NH+]1CCc2cc(OC)c(OC)cc2[C@@H]1C |
| InChI | InChI=1S/C15H19NO2/c1-5-7-16-8-6-12-9-14(17-3)15(18-4)10-13(12)11(16)2/h1,9-11H,6-8H2,2-4H3/p+1/t11-/m0/s1 |
| InChIKey | IIRXVYCZSANUBQ-NSHDSACASA-O |
| XLogP | 0.84 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|