C26H34N2O7 — CID 6575509
N-[(7S)-10-[2,2-dimethoxyethyl(methyl)amino]-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide (PubChem CID 6575509) has the molecular formula C26H34N2O7 and a molecular weight of 486.57 g/mol. Its IUPAC name is N-[(7S)-10-[2,2-dimethoxyethyl(methyl)amino]-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide.
| Compound Name | N-[(7S)-10-[2,2-dimethoxyethyl(methyl)amino]-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide |
|---|---|
| PubChem CID | 6575509 |
| Molecular Formula | C26H34N2O7 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | N-[(7S)-10-[2,2-dimethoxyethyl(methyl)amino]-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(N(C)CC(OC)OC)c(=O)cc1[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C26H34N2O7/c1-15(29)27-19-10-8-16-12-22(31-3)25(34-6)26(35-7)24(16)17-9-11-20(21(30)13-18(17)19)28(2)14-23(32-4)33-5/h9,11-13,19,23H,8,10,14H2,1-7H3,(H,27,29)/t19-/m0/s1 |
| InChIKey | ADNUCILXLLUQAP-IBGZPJMESA-N |
| XLogP | 2.92 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|