C24H31N3O5 — CID 58658602
N-[(8S)-8-acetamido-13,14,15-trimethoxy-5-tricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaenyl]-2-(dimethylamino)acetamide (PubChem CID 58658602) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is N-[(8S)-8-acetamido-13,14,15-trimethoxy-5-tricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaenyl]-2-(dimethylamino)acetamide.
| Compound Name | N-[(8S)-8-acetamido-13,14,15-trimethoxy-5-tricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaenyl]-2-(dimethylamino)acetamide |
|---|---|
| PubChem CID | 58658602 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | N-[(8S)-8-acetamido-13,14,15-trimethoxy-5-tricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaenyl]-2-(dimethylamino)acetamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NC(=O)CN(C)C)cc1[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C24H31N3O5/c1-14(28)25-19-10-7-15-11-20(30-4)23(31-5)24(32-6)22(15)17-9-8-16(12-18(17)19)26-21(29)13-27(2)3/h8-9,11-12,19H,7,10,13H2,1-6H3,(H,25,28)(H,26,29)/t19-/m0/s1 |
| InChIKey | FDSQKMCVCNIDHC-IBGZPJMESA-N |
| XLogP | 3.00 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |