C18H21N5O — CID 657676
2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N-phenyl-N-propan-2-ylacetamide (PubChem CID 657676) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N-phenyl-N-propan-2-ylacetamide.
| Compound Name | 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N-phenyl-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 657676 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 2-[cyano-(4,6-dimethylpyrimidin-2-yl)amino]-N-phenyl-N-propan-2-ylacetamide |
| SMILES | Cc1cc(C)nc(N(C#N)CC(=O)N(c2ccccc2)C(C)C)n1 |
| InChI | InChI=1S/C18H21N5O/c1-13(2)23(16-8-6-5-7-9-16)17(24)11-22(12-19)18-20-14(3)10-15(4)21-18/h5-10,13H,11H2,1-4H3 |
| InChIKey | RCTUBYQDUKMGEA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 73.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|