C19H19N5O2S — CID 658006
2-[[6-amino-4-(4-butoxyphenyl)-3,5-dicyano-2-pyridinyl]sulfanyl]acetamide (PubChem CID 658006) has the molecular formula C19H19N5O2S and a molecular weight of 381.46 g/mol. Its IUPAC name is 2-[[6-amino-4-(4-butoxyphenyl)-3,5-dicyano-2-pyridinyl]sulfanyl]acetamide.
| Compound Name | 2-[[6-amino-4-(4-butoxyphenyl)-3,5-dicyano-2-pyridinyl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 658006 |
| Molecular Formula | C19H19N5O2S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 2-[[6-amino-4-(4-butoxyphenyl)-3,5-dicyano-2-pyridinyl]sulfanyl]acetamide |
| SMILES | CCCCOc1ccc(-c2c(C#N)c(N)nc(SCC(N)=O)c2C#N)cc1 |
| InChI | InChI=1S/C19H19N5O2S/c1-2-3-8-26-13-6-4-12(5-7-13)17-14(9-20)18(23)24-19(15(17)10-21)27-11-16(22)25/h4-7H,2-3,8,11H2,1H3,(H2,22,25)(H2,23,24) |
| InChIKey | JWHUPMGSVKBJGC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 138.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|