C25H25N3O2S — CID 6581037
[(3S)-4-(3-methoxyphenyl)-3-methylpiperazin-1-yl]-phenothiazin-10-ylmethanone (PubChem CID 6581037) has the molecular formula C25H25N3O2S and a molecular weight of 431.56 g/mol. Its IUPAC name is [(3S)-4-(3-methoxyphenyl)-3-methylpiperazin-1-yl]-phenothiazin-10-ylmethanone.
| Compound Name | [(3S)-4-(3-methoxyphenyl)-3-methylpiperazin-1-yl]-phenothiazin-10-ylmethanone |
|---|---|
| PubChem CID | 6581037 |
| Molecular Formula | C25H25N3O2S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | [(3S)-4-(3-methoxyphenyl)-3-methylpiperazin-1-yl]-phenothiazin-10-ylmethanone |
| SMILES | COc1cccc(N2CCN(C(=O)N3c4ccccc4Sc4ccccc43)C[C@@H]2C)c1 |
| InChI | InChI=1S/C25H25N3O2S/c1-18-17-26(14-15-27(18)19-8-7-9-20(16-19)30-2)25(29)28-21-10-3-5-12-23(21)31-24-13-6-4-11-22(24)28/h3-13,16,18H,14-15,17H2,1-2H3/t18-/m0/s1 |
| InChIKey | SASIHYJRVRVPCN-SFHVURJKSA-N |
| XLogP | 5.63 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |