About (3E,6S)-3-[(2-bromophenyl)methylidene]-6-methylpiperazine-2,5-dione
(3E,6S)-3-[(2-bromophenyl)methylidene]-6-methylpiperazine-2,5-dione (PubChem CID 6581795) has the molecular formula C12H11BrN2O2
and a molecular weight of 295.14 g/mol. Its IUPAC name is (3E,6S)-3-[(2-bromophenyl)methylidene]-6-methylpiperazine-2,5-dione.
Molecular Properties
| Compound Name | (3E,6S)-3-[(2-bromophenyl)methylidene]-6-methylpiperazine-2,5-dione |
| PubChem CID | 6581795 |
| Molecular Formula | C12H11BrN2O2 |
| Molecular Weight | 295.14 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | (3E,6S)-3-[(2-bromophenyl)methylidene]-6-methylpiperazine-2,5-dione |
| SMILES | C[C@@H]1NC(=O)/C(=C\c2ccccc2Br)NC1=O |
| InChI | InChI=1S/C12H11BrN2O2/c1-7-11(16)15-10(12(17)14-7)6-8-4-2-3-5-9(8)13/h2-7H,1H3,(H,14,17)(H,15,16)/b10-6+/t7-/m0/s1 |
| InChIKey | DCGMYNCGOUEULX-FSEMZKDTSA-N |
| XLogP | 1.42 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.14 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E,6S)-3-[(2-bromophenyl)methylidene]-6-methylpiperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,6S)-3-[(2-bromophenyl)methylidene]-6-methylpiperazine-2,5-dione?
The IUPAC name of (3E,6S)-3-[(2-bromophenyl)methylidene]-6-methylpiperazine-2,5-dione (CID 6581795) is (3E,6S)-3-[(2-bromophenyl)methylidene]-6-methylpiperazine-2,5-dione.
What is the SMILES notation for (3E,6S)-3-[(2-bromophenyl)methylidene]-6-methylpiperazine-2,5-dione?
The canonical SMILES for (3E,6S)-3-[(2-bromophenyl)methylidene]-6-methylpiperazine-2,5-dione is C[C@@H]1NC(=O)/C(=C\c2ccccc2Br)NC1=O.
What is the InChIKey of (3E,6S)-3-[(2-bromophenyl)methylidene]-6-methylpiperazine-2,5-dione?
The InChIKey is DCGMYNCGOUEULX-FSEMZKDTSA-N. The full InChI is InChI=1S/C12H11BrN2O2/c1-7-11(16)15-10(12(17)14-7)6-8-4-2-3-5-9(8)13/h2-7H,1H3,(H,14,17)(H,15,16)/b10-6+/t7-/m0/s1.
What are the key properties of (3E,6S)-3-[(2-bromophenyl)methylidene]-6-methylpiperazine-2,5-dione?
(3E,6S)-3-[(2-bromophenyl)methylidene]-6-methylpiperazine-2,5-dione has a molecular weight of 295.14 g/mol, XLogP of 1.42, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,6S)-3-[(2-bromophenyl)methylidene]-6-methylpiperazine-2,5-dione is sourced from PubChem (CID 6581795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).