C9H17N2O4P — CID 658487
[formyl(methyl)amino]methyl-[2-(2-oxopyrrolidin-1-yl)ethyl]phosphinic acid (PubChem CID 658487) has the molecular formula C9H17N2O4P and a molecular weight of 248.22 g/mol. Its IUPAC name is [formyl(methyl)amino]methyl-[2-(2-oxopyrrolidin-1-yl)ethyl]phosphinic acid.
| Compound Name | [formyl(methyl)amino]methyl-[2-(2-oxopyrrolidin-1-yl)ethyl]phosphinic acid |
|---|---|
| PubChem CID | 658487 |
| Molecular Formula | C9H17N2O4P |
| Molecular Weight | 248.22 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | [formyl(methyl)amino]methyl-[2-(2-oxopyrrolidin-1-yl)ethyl]phosphinic acid |
| SMILES | CN(C=O)CP(=O)(O)CCN1CCCC1=O |
| InChI | InChI=1S/C9H17N2O4P/c1-10(7-12)8-16(14,15)6-5-11-4-2-3-9(11)13/h7H,2-6,8H2,1H3,(H,14,15) |
| InChIKey | WVHLWURBFSWFDB-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.22 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|