C27H23BrN2O2 — CID 6586546
(10R,11R,15R,16S)-16-(4-bromophenyl)-13-(4-methylphenyl)-1,13-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,5,7-triene-12,14-dione (PubChem CID 6586546) has the molecular formula C27H23BrN2O2 and a molecular weight of 487.40 g/mol. Its IUPAC name is (10R,11R,15R,16S)-16-(4-bromophenyl)-13-(4-methylphenyl)-1,13-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,5,7-triene-12,14-dione.
| Compound Name | (10R,11R,15R,16S)-16-(4-bromophenyl)-13-(4-methylphenyl)-1,13-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,5,7-triene-12,14-dione |
|---|---|
| PubChem CID | 6586546 |
| Molecular Formula | C27H23BrN2O2 |
| Molecular Weight | 487.40 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | (10R,11R,15R,16S)-16-(4-bromophenyl)-13-(4-methylphenyl)-1,13-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,5,7-triene-12,14-dione |
| SMILES | Cc1ccc(N2C(=O)[C@@H]3[C@@H](C2=O)[C@@H](c2ccc(Br)cc2)N2Cc4ccccc4C[C@H]32)cc1 |
| InChI | InChI=1S/C27H23BrN2O2/c1-16-6-12-21(13-7-16)30-26(31)23-22-14-18-4-2-3-5-19(18)15-29(22)25(24(23)27(30)32)17-8-10-20(28)11-9-17/h2-13,22-25H,14-15H2,1H3/t22-,23+,24-,25-/m1/s1 |
| InChIKey | IHCCNYSQNVISOB-ZFFYZDHPSA-N |
| XLogP | 5.04 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.40 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|