About 6-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione
6-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione (PubChem CID 658918) has the molecular formula C11H10N2O3
and a molecular weight of 218.21 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione |
| PubChem CID | 658918 |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 6-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione |
| SMILES | COc1ccc(-c2cc(=O)[nH]c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C11H10N2O3/c1-16-8-4-2-7(3-5-8)9-6-10(14)13-11(15)12-9/h2-6H,1H3,(H2,12,13,14,15) |
| InChIKey | XAIOLTHASPQESG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione?
The IUPAC name of 6-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione (CID 658918) is 6-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 6-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione?
The canonical SMILES for 6-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione is COc1ccc(-c2cc(=O)[nH]c(=O)[nH]2)cc1.
What is the InChIKey of 6-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione?
The InChIKey is XAIOLTHASPQESG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O3/c1-16-8-4-2-7(3-5-8)9-6-10(14)13-11(15)12-9/h2-6H,1H3,(H2,12,13,14,15).
What are the key properties of 6-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione?
6-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione has a molecular weight of 218.21 g/mol, XLogP of 0.74, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-methoxyphenyl)-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 658918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).