C30H21N3O3S — CID 6589188
(1'S,2'R,3R,3'aR)-2'-(pyridine-2-carbonyl)-1'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one (PubChem CID 6589188) has the molecular formula C30H21N3O3S and a molecular weight of 503.58 g/mol. Its IUPAC name is (1'S,2'R,3R,3'aR)-2'-(pyridine-2-carbonyl)-1'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one.
| Compound Name | (1'S,2'R,3R,3'aR)-2'-(pyridine-2-carbonyl)-1'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
|---|---|
| PubChem CID | 6589188 |
| Molecular Formula | C30H21N3O3S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | (1'S,2'R,3R,3'aR)-2'-(pyridine-2-carbonyl)-1'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
| SMILES | O=C(c1cccs1)[C@@H]1[C@H](C(=O)c2ccccn2)[C@]2(C(=O)Nc3ccccc32)[C@H]2C=Cc3ccccc3N12 |
| InChI | InChI=1S/C30H21N3O3S/c34-27(21-11-5-6-16-31-21)25-26(28(35)23-13-7-17-37-23)33-22-12-4-1-8-18(22)14-15-24(33)30(25)19-9-2-3-10-20(19)32-29(30)36/h1-17,24-26H,(H,32,36)/t24-,25-,26+,30-/m1/s1 |
| InChIKey | PGKSFOBXHNEJOC-CPBHOCDRSA-N |
| XLogP | 5.00 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |