C32H22Cl2N2O3S — CID 6589958
(1'R,2'S,3R,3'aS)-2'-(2,4-dichlorobenzoyl)-5'-methyl-1'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one (PubChem CID 6589958) has the molecular formula C32H22Cl2N2O3S and a molecular weight of 585.51 g/mol. Its IUPAC name is (1'R,2'S,3R,3'aS)-2'-(2,4-dichlorobenzoyl)-5'-methyl-1'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one.
| Compound Name | (1'R,2'S,3R,3'aS)-2'-(2,4-dichlorobenzoyl)-5'-methyl-1'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
|---|---|
| PubChem CID | 6589958 |
| Molecular Formula | C32H22Cl2N2O3S |
| Molecular Weight | 585.51 g/mol |
| Exact Mass | 584.07 |
| IUPAC Name | (1'R,2'S,3R,3'aS)-2'-(2,4-dichlorobenzoyl)-5'-methyl-1'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
| SMILES | CC1=C[C@@H]2N(c3ccccc31)[C@@H](C(=O)c1cccs1)[C@@H](C(=O)c1ccc(Cl)cc1Cl)[C@]21C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C32H22Cl2N2O3S/c1-17-15-26-32(21-8-3-4-9-23(21)35-31(32)39)27(29(37)20-13-12-18(33)16-22(20)34)28(30(38)25-11-6-14-40-25)36(26)24-10-5-2-7-19(17)24/h2-16,26-28H,1H3,(H,35,39)/t26-,27-,28+,32+/m0/s1 |
| InChIKey | HEWPIHIHNPBOJG-NAQGONTDSA-N |
| XLogP | 7.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.51 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |