C33H26N2O3S — CID 100886185
(1'S,2'R,3R,3'aS)-5'-methyl-2'-(4-methylbenzoyl)-1'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one (PubChem CID 100886185) has the molecular formula C33H26N2O3S and a molecular weight of 530.65 g/mol. Its IUPAC name is (1'S,2'R,3R,3'aS)-5'-methyl-2'-(4-methylbenzoyl)-1'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one.
| Compound Name | (1'S,2'R,3R,3'aS)-5'-methyl-2'-(4-methylbenzoyl)-1'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
|---|---|
| PubChem CID | 100886185 |
| Molecular Formula | C33H26N2O3S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | (1'S,2'R,3R,3'aS)-5'-methyl-2'-(4-methylbenzoyl)-1'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
| SMILES | CC1=C[C@@H]2N(c3ccccc31)[C@H](C(=O)c1cccs1)[C@H](C(=O)c1ccc(C)cc1)[C@]21C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C33H26N2O3S/c1-19-13-15-21(16-14-19)30(36)28-29(31(37)26-12-7-17-39-26)35-25-11-6-3-8-22(25)20(2)18-27(35)33(28)23-9-4-5-10-24(23)34-32(33)38/h3-18,27-29H,1-2H3,(H,34,38)/t27-,28+,29-,33+/m0/s1 |
| InChIKey | GNARQZJKIVFXNO-KCIBBDPESA-N |
| XLogP | 6.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |