C37H34N2O3S — CID 100832212
(1'R,2'S,3R,3'aR)-5'-methyl-2'-(4-pentylbenzoyl)-1'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one (PubChem CID 100832212) has the molecular formula C37H34N2O3S and a molecular weight of 586.76 g/mol. Its IUPAC name is (1'R,2'S,3R,3'aR)-5'-methyl-2'-(4-pentylbenzoyl)-1'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one.
| Compound Name | (1'R,2'S,3R,3'aR)-5'-methyl-2'-(4-pentylbenzoyl)-1'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
|---|---|
| PubChem CID | 100832212 |
| Molecular Formula | C37H34N2O3S |
| Molecular Weight | 586.76 g/mol |
| Exact Mass | 586.23 |
| IUPAC Name | (1'R,2'S,3R,3'aR)-5'-methyl-2'-(4-pentylbenzoyl)-1'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
| SMILES | CCCCCc1ccc(C(=O)[C@@H]2[C@H](C(=O)c3cccs3)N3c4ccccc4C(C)=C[C@@H]3[C@@]23C(=O)Nc2ccccc23)cc1 |
| InChI | InChI=1S/C37H34N2O3S/c1-3-4-5-11-24-17-19-25(20-18-24)34(40)32-33(35(41)30-16-10-21-43-30)39-29-15-9-6-12-26(29)23(2)22-31(39)37(32)27-13-7-8-14-28(27)38-36(37)42/h6-10,12-22,31-33H,3-5,11H2,1-2H3,(H,38,42)/t31-,32+,33-,37-/m1/s1 |
| InChIKey | CMMYHEXUPJBYIO-CSSWAUQYSA-N |
| XLogP | 7.73 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.76 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|