C34H28N2O3S — CID 98198478
(1'S,2'S,3S,3'aR)-5',7'-dimethyl-2'-(4-methylbenzoyl)-1'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one (PubChem CID 98198478) has the molecular formula C34H28N2O3S and a molecular weight of 544.68 g/mol. Its IUPAC name is (1'S,2'S,3S,3'aR)-5',7'-dimethyl-2'-(4-methylbenzoyl)-1'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one.
| Compound Name | (1'S,2'S,3S,3'aR)-5',7'-dimethyl-2'-(4-methylbenzoyl)-1'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
|---|---|
| PubChem CID | 98198478 |
| Molecular Formula | C34H28N2O3S |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | (1'S,2'S,3S,3'aR)-5',7'-dimethyl-2'-(4-methylbenzoyl)-1'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
| SMILES | CC1=C[C@H]2N(c3ccc(C)cc31)[C@H](C(=O)c1cccs1)[C@@H](C(=O)c1ccc(C)cc1)[C@@]21C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C34H28N2O3S/c1-19-10-13-22(14-11-19)31(37)29-30(32(38)27-9-6-16-40-27)36-26-15-12-20(2)17-23(26)21(3)18-28(36)34(29)24-7-4-5-8-25(24)35-33(34)39/h4-18,28-30H,1-3H3,(H,35,39)/t28-,29+,30+,34+/m1/s1 |
| InChIKey | GXTWKOGLUZIUQJ-JUQCDRLLSA-N |
| XLogP | 6.61 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |