C32H23ClN2O3S — CID 6590081
(1'S,2'R,3R,3'aR)-1'-(4-chlorobenzoyl)-7'-methyl-2'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one (PubChem CID 6590081) has the molecular formula C32H23ClN2O3S and a molecular weight of 551.07 g/mol. Its IUPAC name is (1'S,2'R,3R,3'aR)-1'-(4-chlorobenzoyl)-7'-methyl-2'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one.
| Compound Name | (1'S,2'R,3R,3'aR)-1'-(4-chlorobenzoyl)-7'-methyl-2'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
|---|---|
| PubChem CID | 6590081 |
| Molecular Formula | C32H23ClN2O3S |
| Molecular Weight | 551.07 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | (1'S,2'R,3R,3'aR)-1'-(4-chlorobenzoyl)-7'-methyl-2'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
| SMILES | Cc1ccc2c(c1)C=C[C@H]1N2[C@H](C(=O)c2ccc(Cl)cc2)[C@H](C(=O)c2cccs2)[C@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C32H23ClN2O3S/c1-18-8-14-24-20(17-18)11-15-26-32(22-5-2-3-6-23(22)34-31(32)38)27(30(37)25-7-4-16-39-25)28(35(24)26)29(36)19-9-12-21(33)13-10-19/h2-17,26-28H,1H3,(H,34,38)/t26-,27-,28+,32-/m1/s1 |
| InChIKey | FSTVWFOEGZOODZ-YSGXDJDMSA-N |
| XLogP | 6.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.07 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |