C31H20Cl2N2O3S — CID 98379476
(1'R,2'R,3S,3'aR)-7'-chloro-2'-(2-chlorobenzoyl)-1'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one (PubChem CID 98379476) has the molecular formula C31H20Cl2N2O3S and a molecular weight of 571.49 g/mol. Its IUPAC name is (1'R,2'R,3S,3'aR)-7'-chloro-2'-(2-chlorobenzoyl)-1'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one.
| Compound Name | (1'R,2'R,3S,3'aR)-7'-chloro-2'-(2-chlorobenzoyl)-1'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
|---|---|
| PubChem CID | 98379476 |
| Molecular Formula | C31H20Cl2N2O3S |
| Molecular Weight | 571.49 g/mol |
| Exact Mass | 570.06 |
| IUPAC Name | (1'R,2'R,3S,3'aR)-7'-chloro-2'-(2-chlorobenzoyl)-1'-(thiophene-2-carbonyl)spiro[1H-indole-3,3'-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline]-2-one |
| SMILES | O=C(c1cccs1)[C@H]1[C@H](C(=O)c2ccccc2Cl)[C@@]2(C(=O)Nc3ccccc32)[C@H]2C=Cc3cc(Cl)ccc3N12 |
| InChI | InChI=1S/C31H20Cl2N2O3S/c32-18-12-13-23-17(16-18)11-14-25-31(20-7-2-4-9-22(20)34-30(31)38)26(28(36)19-6-1-3-8-21(19)33)27(35(23)25)29(37)24-10-5-15-39-24/h1-16,25-27H,(H,34,38)/t25-,26-,27-,31+/m1/s1 |
| InChIKey | OQXIXKSPTORELV-VHBXCGMBSA-N |
| XLogP | 6.91 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.49 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |